C18H32N4O7S — CID 167028279
2-[4,7-bis(carboxymethyl)-10-(2-oxo-3-sulfanylbutyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 167028279) has the molecular formula C18H32N4O7S and a molecular weight of 448.54 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-(2-oxo-3-sulfanylbutyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-(2-oxo-3-sulfanylbutyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 167028279 |
| Molecular Formula | C18H32N4O7S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-(2-oxo-3-sulfanylbutyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CC(S)C(=O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C18H32N4O7S/c1-14(30)15(23)10-19-2-4-20(11-16(24)25)6-8-22(13-18(28)29)9-7-21(5-3-19)12-17(26)27/h14,30H,2-13H2,1H3,(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | BGLHQJMKYUGLEK-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 141.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|