C17H32N4O6S — CID 134517440
2-[4,7-bis(carboxymethyl)-10-(2-sulfanylpropyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 134517440) has the molecular formula C17H32N4O6S and a molecular weight of 420.53 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-(2-sulfanylpropyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-(2-sulfanylpropyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 134517440 |
| Molecular Formula | C17H32N4O6S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-(2-sulfanylpropyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CC(S)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C17H32N4O6S/c1-14(28)10-18-2-4-19(11-15(22)23)6-8-21(13-17(26)27)9-7-20(5-3-18)12-16(24)25/h14,28H,2-13H2,1H3,(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | APNMZWYYEFRPJT-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 124.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|