C10H20N2O4 — CID 56716645
2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]acetic acid (PubChem CID 56716645) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is 2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 56716645 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]acetic acid |
| SMILES | COC(CN1CCN(CC(=O)O)CC1)OC |
| InChI | InChI=1S/C10H20N2O4/c1-15-10(16-2)8-12-5-3-11(4-6-12)7-9(13)14/h10H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | CWFJZBLAKUFCDF-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|