2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]acetic acid

C10H20N2O4 — CID 56716645

IUPAC2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]acetic acid
SMILESCOC(CN1CCN(CC(=O)O)CC1)OC
InChIInChI=1S/C10H20N2O4/c1-15-10(16-2)8-12-5-3-11(4-6-12)7-9(13)14/h10H,3-8H2,1-2H3,(H,13,14)
InChIKeyCWFJZBLAKUFCDF-UHFFFAOYSA-N
MW232.28 g/mol
LogP-0.69
Rot. Bonds6

About 2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]acetic acid

2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]acetic acid (PubChem CID 56716645) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is 2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]acetic acid.

Molecular Properties

Compound Name2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]acetic acid
PubChem CID56716645
Molecular FormulaC10H20N2O4
Molecular Weight232.28 g/mol
Exact Mass232.14
IUPAC Name2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]acetic acid
SMILESCOC(CN1CCN(CC(=O)O)CC1)OC
InChIInChI=1S/C10H20N2O4/c1-15-10(16-2)8-12-5-3-11(4-6-12)7-9(13)14/h10H,3-8H2,1-2H3,(H,13,14)
InChIKeyCWFJZBLAKUFCDF-UHFFFAOYSA-N
XLogP-0.69
TPSA62.24 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.28
LogP ≤ 5-0.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]acetic acid?
The IUPAC name of 2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]acetic acid (CID 56716645) is 2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]acetic acid.
What is the SMILES notation for 2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]acetic acid?
The canonical SMILES for 2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]acetic acid is COC(CN1CCN(CC(=O)O)CC1)OC.
What is the InChIKey of 2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]acetic acid?
The InChIKey is CWFJZBLAKUFCDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O4/c1-15-10(16-2)8-12-5-3-11(4-6-12)7-9(13)14/h10H,3-8H2,1-2H3,(H,13,14).
What are the key properties of 2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]acetic acid?
2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]acetic acid has a molecular weight of 232.28 g/mol, XLogP of -0.69, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]acetic acid is sourced from PubChem (CID 56716645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).