C10H22N2O3 — CID 66222329
2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]ethanol (PubChem CID 66222329) has the molecular formula C10H22N2O3 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]ethanol.
| Compound Name | 2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 66222329 |
| Molecular Formula | C10H22N2O3 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]ethanol |
| SMILES | COC(CN1CCN(CCO)CC1)OC |
| InChI | InChI=1S/C10H22N2O3/c1-14-10(15-2)9-12-5-3-11(4-6-12)7-8-13/h10,13H,3-9H2,1-2H3 |
| InChIKey | PHOHVYXNDVZACA-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|