C12H27N3O2 — CID 66222136
2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]-N,N-dimethylethanamine (PubChem CID 66222136) has the molecular formula C12H27N3O2 and a molecular weight of 245.37 g/mol. Its IUPAC name is 2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 66222136 |
| Molecular Formula | C12H27N3O2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 2-[4-(2,2-dimethoxyethyl)piperazin-1-yl]-N,N-dimethylethanamine |
| SMILES | COC(CN1CCN(CCN(C)C)CC1)OC |
| InChI | InChI=1S/C12H27N3O2/c1-13(2)5-6-14-7-9-15(10-8-14)11-12(16-3)17-4/h12H,5-11H2,1-4H3 |
| InChIKey | GDBVPBYGLGMBPN-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|