C24H48N8 — CID 155177393
2-[13-[2-(dimethylamino)ethyl]-1,4,7,10,13,16-hexazatricyclo[14.2.2.27,10]docosa-8,17-dien-4-yl]-N,N-dimethylethanamine (PubChem CID 155177393) has the molecular formula C24H48N8 and a molecular weight of 448.70 g/mol. Its IUPAC name is 2-[13-[2-(dimethylamino)ethyl]-1,4,7,10,13,16-hexazatricyclo[14.2.2.27,10]docosa-8,17-dien-4-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[13-[2-(dimethylamino)ethyl]-1,4,7,10,13,16-hexazatricyclo[14.2.2.27,10]docosa-8,17-dien-4-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 155177393 |
| Molecular Formula | C24H48N8 |
| Molecular Weight | 448.70 g/mol |
| Exact Mass | 448.40 |
| IUPAC Name | 2-[13-[2-(dimethylamino)ethyl]-1,4,7,10,13,16-hexazatricyclo[14.2.2.27,10]docosa-8,17-dien-4-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCN1CCN2C=CN(CC2)CCN(CCN(C)C)CCN2C=CN(CC2)CC1 |
| InChI | InChI=1S/C24H48N8/c1-25(2)5-7-27-9-13-29-17-21-31(22-18-29)15-11-28(8-6-26(3)4)12-16-32-23-19-30(14-10-27)20-24-32/h17,19,21,23H,5-16,18,20,22,24H2,1-4H3 |
| InChIKey | VCIUPKCTYVSWBH-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 25.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.70 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |