C13H25N3 — CID 115872596
N,N-dimethyl-2-(4-pent-4-ynylpiperazin-1-yl)ethanamine (PubChem CID 115872596) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is N,N-dimethyl-2-(4-pent-4-ynylpiperazin-1-yl)ethanamine.
| Compound Name | N,N-dimethyl-2-(4-pent-4-ynylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 115872596 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | N,N-dimethyl-2-(4-pent-4-ynylpiperazin-1-yl)ethanamine |
| SMILES | C#CCCCN1CCN(CCN(C)C)CC1 |
| InChI | InChI=1S/C13H25N3/c1-4-5-6-7-15-10-12-16(13-11-15)9-8-14(2)3/h1H,5-13H2,2-3H3 |
| InChIKey | LUJVHYCECCKBOF-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|