C7H16N2 — CID 154296752
3-(aziridin-1-yl)-N,N-dimethylpropan-1-amine (PubChem CID 154296752) has the molecular formula C7H16N2 and a molecular weight of 128.22 g/mol. Its IUPAC name is 3-(aziridin-1-yl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(aziridin-1-yl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 154296752 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | 3-(aziridin-1-yl)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCN1CC1 |
| InChI | InChI=1S/C7H16N2/c1-8(2)4-3-5-9-6-7-9/h3-7H2,1-2H3 |
| InChIKey | HAWAXBUHZZANHJ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|