C18H45N3 — CID 166169560
1-butyl-4-methylpiperazine;N,N-dimethylpropan-1-amine;ethane (PubChem CID 166169560) has the molecular formula C18H45N3 and a molecular weight of 303.58 g/mol. Its IUPAC name is 1-butyl-4-methylpiperazine;N,N-dimethylpropan-1-amine;ethane.
| Compound Name | 1-butyl-4-methylpiperazine;N,N-dimethylpropan-1-amine;ethane |
|---|---|
| PubChem CID | 166169560 |
| Molecular Formula | C18H45N3 |
| Molecular Weight | 303.58 g/mol |
| Exact Mass | 303.36 |
| IUPAC Name | 1-butyl-4-methylpiperazine;N,N-dimethylpropan-1-amine;ethane |
| SMILES | CC.CC.CCCCN1CCN(C)CC1.CCCN(C)C |
| InChI | InChI=1S/C9H20N2.C5H13N.2C2H6/c1-3-4-5-11-8-6-10(2)7-9-11;1-4-5-6(2)3;2*1-2/h3-9H2,1-2H3;4-5H2,1-3H3;2*1-2H3 |
| InChIKey | LVJYPLUZPIGZTN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |