About methane;1-methyl-4-[3-(4-propylpiperazin-1-yl)propyl]piperazine;propane
methane;1-methyl-4-[3-(4-propylpiperazin-1-yl)propyl]piperazine;propane (PubChem CID 156885712) has the molecular formula C19H44N4
and a molecular weight of 328.59 g/mol. Its IUPAC name is methane;1-methyl-4-[3-(4-propylpiperazin-1-yl)propyl]piperazine;propane.
Molecular Properties
| Compound Name | methane;1-methyl-4-[3-(4-propylpiperazin-1-yl)propyl]piperazine;propane |
| PubChem CID | 156885712 |
| Molecular Formula | C19H44N4 |
| Molecular Weight | 328.59 g/mol |
| Exact Mass | 328.36 |
| IUPAC Name | methane;1-methyl-4-[3-(4-propylpiperazin-1-yl)propyl]piperazine;propane |
| SMILES | C.CCC.CCCN1CCN(CCCN2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C15H32N4.C3H8.CH4/c1-3-5-17-12-14-19(15-13-17)7-4-6-18-10-8-16(2)9-11-18;1-3-2;/h3-15H2,1-2H3;3H2,1-2H3;1H4 |
| InChIKey | GNDDPMXDHXHEGT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.59 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methane;1-methyl-4-[3-(4-propylpiperazin-1-yl)propyl]piperazine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-methyl-4-[3-(4-propylpiperazin-1-yl)propyl]piperazine;propane?
The IUPAC name of methane;1-methyl-4-[3-(4-propylpiperazin-1-yl)propyl]piperazine;propane (CID 156885712) is methane;1-methyl-4-[3-(4-propylpiperazin-1-yl)propyl]piperazine;propane.
What is the SMILES notation for methane;1-methyl-4-[3-(4-propylpiperazin-1-yl)propyl]piperazine;propane?
The canonical SMILES for methane;1-methyl-4-[3-(4-propylpiperazin-1-yl)propyl]piperazine;propane is C.CCC.CCCN1CCN(CCCN2CCN(C)CC2)CC1.
What is the InChIKey of methane;1-methyl-4-[3-(4-propylpiperazin-1-yl)propyl]piperazine;propane?
The InChIKey is GNDDPMXDHXHEGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32N4.C3H8.CH4/c1-3-5-17-12-14-19(15-13-17)7-4-6-18-10-8-16(2)9-11-18;1-3-2;/h3-15H2,1-2H3;3H2,1-2H3;1H4.
What are the key properties of methane;1-methyl-4-[3-(4-propylpiperazin-1-yl)propyl]piperazine;propane?
methane;1-methyl-4-[3-(4-propylpiperazin-1-yl)propyl]piperazine;propane has a molecular weight of 328.59 g/mol, XLogP of 2.70, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-methyl-4-[3-(4-propylpiperazin-1-yl)propyl]piperazine;propane is sourced from PubChem (CID 156885712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).