C24H54N8 — CID 21130153
1,4,7-trimethyl-10-[2-(4,7,10-trimethyl-1,4,7,10-tetrazacyclododec-1-yl)ethyl]-1,4,7,10-tetrazacyclododecane (PubChem CID 21130153) has the molecular formula C24H54N8 and a molecular weight of 454.75 g/mol. Its IUPAC name is 1,4,7-trimethyl-10-[2-(4,7,10-trimethyl-1,4,7,10-tetrazacyclododec-1-yl)ethyl]-1,4,7,10-tetrazacyclododecane.
| Compound Name | 1,4,7-trimethyl-10-[2-(4,7,10-trimethyl-1,4,7,10-tetrazacyclododec-1-yl)ethyl]-1,4,7,10-tetrazacyclododecane |
|---|---|
| PubChem CID | 21130153 |
| Molecular Formula | C24H54N8 |
| Molecular Weight | 454.75 g/mol |
| Exact Mass | 454.45 |
| IUPAC Name | 1,4,7-trimethyl-10-[2-(4,7,10-trimethyl-1,4,7,10-tetrazacyclododec-1-yl)ethyl]-1,4,7,10-tetrazacyclododecane |
| SMILES | CN1CCN(C)CCN(CCN2CCN(C)CCN(C)CCN(C)CC2)CCN(C)CC1 |
| InChI | InChI=1S/C24H54N8/c1-25-7-11-27(3)15-19-31(20-16-28(4)12-8-25)23-24-32-21-17-29(5)13-9-26(2)10-14-30(6)18-22-32/h7-24H2,1-6H3 |
| InChIKey | KVCIZSWQQBBGPP-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 25.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.75 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |