About ethane;2-(4-methylpiperazin-1-yl)ethanol;vanadium
ethane;2-(4-methylpiperazin-1-yl)ethanol;vanadium (PubChem CID 176984837) has the molecular formula C9H22N2OV
and a molecular weight of 225.23 g/mol. Its IUPAC name is ethane;2-(4-methylpiperazin-1-yl)ethanol;vanadium.
Molecular Properties
| Compound Name | ethane;2-(4-methylpiperazin-1-yl)ethanol;vanadium |
| PubChem CID | 176984837 |
| Molecular Formula | C9H22N2OV |
| Molecular Weight | 225.23 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | ethane;2-(4-methylpiperazin-1-yl)ethanol;vanadium |
| SMILES | CC.CN1CCN(CCO)CC1.[V] |
| InChI | InChI=1S/C7H16N2O.C2H6.V/c1-8-2-4-9(5-3-8)6-7-10;1-2;/h10H,2-7H2,1H3;1-2H3; |
| InChIKey | YTFZSWFVUXQKGB-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.23 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-(4-methylpiperazin-1-yl)ethanol;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(4-methylpiperazin-1-yl)ethanol;vanadium?
The IUPAC name of ethane;2-(4-methylpiperazin-1-yl)ethanol;vanadium (CID 176984837) is ethane;2-(4-methylpiperazin-1-yl)ethanol;vanadium.
What is the SMILES notation for ethane;2-(4-methylpiperazin-1-yl)ethanol;vanadium?
The canonical SMILES for ethane;2-(4-methylpiperazin-1-yl)ethanol;vanadium is CC.CN1CCN(CCO)CC1.[V].
What is the InChIKey of ethane;2-(4-methylpiperazin-1-yl)ethanol;vanadium?
The InChIKey is YTFZSWFVUXQKGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O.C2H6.V/c1-8-2-4-9(5-3-8)6-7-10;1-2;/h10H,2-7H2,1H3;1-2H3;.
What are the key properties of ethane;2-(4-methylpiperazin-1-yl)ethanol;vanadium?
ethane;2-(4-methylpiperazin-1-yl)ethanol;vanadium has a molecular weight of 225.23 g/mol, XLogP of 0.25, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(4-methylpiperazin-1-yl)ethanol;vanadium is sourced from PubChem (CID 176984837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).