C14H30FN3O2Y — CID 176949040
2-(4-methylpiperazin-1-yl)ethanol;2-piperidin-1-ylethyl hypofluorite;yttrium (PubChem CID 176949040) has the molecular formula C14H30FN3O2Y and a molecular weight of 380.32 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)ethanol;2-piperidin-1-ylethyl hypofluorite;yttrium.
| Compound Name | 2-(4-methylpiperazin-1-yl)ethanol;2-piperidin-1-ylethyl hypofluorite;yttrium |
|---|---|
| PubChem CID | 176949040 |
| Molecular Formula | C14H30FN3O2Y |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)ethanol;2-piperidin-1-ylethyl hypofluorite;yttrium |
| SMILES | CN1CCN(CCO)CC1.FOCCN1CCCCC1.[Y] |
| InChI | InChI=1S/C7H14FNO.C7H16N2O.Y/c8-10-7-6-9-4-2-1-3-5-9;1-8-2-4-9(5-3-8)6-7-10;/h1-7H2;10H,2-7H2,1H3; |
| InChIKey | WETZYTLRJYKZNV-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |