C9H19FN2O — CID 80695797
2-[4-(2-fluoroethyl)-1,4-diazepan-1-yl]ethanol (PubChem CID 80695797) has the molecular formula C9H19FN2O and a molecular weight of 190.26 g/mol. Its IUPAC name is 2-[4-(2-fluoroethyl)-1,4-diazepan-1-yl]ethanol.
| Compound Name | 2-[4-(2-fluoroethyl)-1,4-diazepan-1-yl]ethanol |
|---|---|
| PubChem CID | 80695797 |
| Molecular Formula | C9H19FN2O |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 2-[4-(2-fluoroethyl)-1,4-diazepan-1-yl]ethanol |
| SMILES | OCCN1CCCN(CCF)CC1 |
| InChI | InChI=1S/C9H19FN2O/c10-2-5-11-3-1-4-12(7-6-11)8-9-13/h13H,1-9H2 |
| InChIKey | JRKMFHMDHLGGBE-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |