About fluoro hypofluorite;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol
fluoro hypofluorite;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol (PubChem CID 70545422) has the molecular formula C8H18F2N2O3
and a molecular weight of 228.24 g/mol. Its IUPAC name is fluoro hypofluorite;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol.
Molecular Properties
| Compound Name | fluoro hypofluorite;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol |
| PubChem CID | 70545422 |
| Molecular Formula | C8H18F2N2O3 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | fluoro hypofluorite;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol |
| SMILES | FOF.OCCN1CCN(CCO)CC1 |
| InChI | InChI=1S/C8H18N2O2.F2O/c11-7-5-9-1-2-10(4-3-9)6-8-12;1-3-2/h11-12H,1-8H2; |
| InChIKey | LUTBJPSBTVWDGC-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze fluoro hypofluorite;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro hypofluorite;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol?
The IUPAC name of fluoro hypofluorite;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol (CID 70545422) is fluoro hypofluorite;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol.
What is the SMILES notation for fluoro hypofluorite;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol?
The canonical SMILES for fluoro hypofluorite;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol is FOF.OCCN1CCN(CCO)CC1.
What is the InChIKey of fluoro hypofluorite;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol?
The InChIKey is LUTBJPSBTVWDGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O2.F2O/c11-7-5-9-1-2-10(4-3-9)6-8-12;1-3-2/h11-12H,1-8H2;.
What are the key properties of fluoro hypofluorite;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol?
fluoro hypofluorite;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol has a molecular weight of 228.24 g/mol, XLogP of -0.64, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro hypofluorite;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol is sourced from PubChem (CID 70545422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).