C10H22N2O5 — CID 67621651
2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol;methyl hydrogen carbonate (PubChem CID 67621651) has the molecular formula C10H22N2O5 and a molecular weight of 250.29 g/mol. Its IUPAC name is 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol;methyl hydrogen carbonate.
| Compound Name | 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol;methyl hydrogen carbonate |
|---|---|
| PubChem CID | 67621651 |
| Molecular Formula | C10H22N2O5 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol;methyl hydrogen carbonate |
| SMILES | COC(=O)O.OCCN1CCN(CCO)CC1 |
| InChI | InChI=1S/C8H18N2O2.C2H4O3/c11-7-5-9-1-2-10(4-3-9)6-8-12;1-5-2(3)4/h11-12H,1-8H2;1H3,(H,3,4) |
| InChIKey | AKRCCGIKCSLDHY-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |