C10H21N3O3 — CID 108890532
4-(2-hydroxyethyl)-N-(2-methoxyethyl)piperazine-1-carboxamide (PubChem CID 108890532) has the molecular formula C10H21N3O3 and a molecular weight of 231.30 g/mol. Its IUPAC name is 4-(2-hydroxyethyl)-N-(2-methoxyethyl)piperazine-1-carboxamide.
| Compound Name | 4-(2-hydroxyethyl)-N-(2-methoxyethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 108890532 |
| Molecular Formula | C10H21N3O3 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 4-(2-hydroxyethyl)-N-(2-methoxyethyl)piperazine-1-carboxamide |
| SMILES | COCCNC(=O)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C10H21N3O3/c1-16-9-2-11-10(15)13-5-3-12(4-6-13)7-8-14/h14H,2-9H2,1H3,(H,11,15) |
| InChIKey | ONTFWNBYVLOYMJ-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|