C12H23N3O5 — CID 107224020
2-[2-[[4-(2-hydroxyethyl)-1,4-diazepane-1-carbonyl]amino]ethoxy]acetic acid (PubChem CID 107224020) has the molecular formula C12H23N3O5 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-[2-[[4-(2-hydroxyethyl)-1,4-diazepane-1-carbonyl]amino]ethoxy]acetic acid.
| Compound Name | 2-[2-[[4-(2-hydroxyethyl)-1,4-diazepane-1-carbonyl]amino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 107224020 |
| Molecular Formula | C12H23N3O5 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 2-[2-[[4-(2-hydroxyethyl)-1,4-diazepane-1-carbonyl]amino]ethoxy]acetic acid |
| SMILES | O=C(O)COCCNC(=O)N1CCCN(CCO)CC1 |
| InChI | InChI=1S/C12H23N3O5/c16-8-7-14-3-1-4-15(6-5-14)12(19)13-2-9-20-10-11(17)18/h16H,1-10H2,(H,13,19)(H,17,18) |
| InChIKey | LTQVLUJFZJTWJG-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|