2-[2-[(4,4-dimethylazepane-1-carbonyl)amino]ethoxy]acetic acid

C13H24N2O4 — CID 79463859

IUPAC2-[2-[(4,4-dimethylazepane-1-carbonyl)amino]ethoxy]acetic acid
SMILESCC1(C)CCCN(C(=O)NCCOCC(=O)O)CC1
InChIInChI=1S/C13H24N2O4/c1-13(2)4-3-7-15(8-5-13)12(18)14-6-9-19-10-11(16)17/h3-10H2,1-2H3,(H,14,18)(H,16,17)
InChIKeyWEERFHDTSSGJKM-UHFFFAOYSA-N
MW272.34 g/mol
LogP1.31
Rot. Bonds5

About 2-[2-[(4,4-dimethylazepane-1-carbonyl)amino]ethoxy]acetic acid

2-[2-[(4,4-dimethylazepane-1-carbonyl)amino]ethoxy]acetic acid (PubChem CID 79463859) has the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. Its IUPAC name is 2-[2-[(4,4-dimethylazepane-1-carbonyl)amino]ethoxy]acetic acid.

Molecular Properties

Compound Name2-[2-[(4,4-dimethylazepane-1-carbonyl)amino]ethoxy]acetic acid
PubChem CID79463859
Molecular FormulaC13H24N2O4
Molecular Weight272.34 g/mol
Exact Mass272.17
IUPAC Name2-[2-[(4,4-dimethylazepane-1-carbonyl)amino]ethoxy]acetic acid
SMILESCC1(C)CCCN(C(=O)NCCOCC(=O)O)CC1
InChIInChI=1S/C13H24N2O4/c1-13(2)4-3-7-15(8-5-13)12(18)14-6-9-19-10-11(16)17/h3-10H2,1-2H3,(H,14,18)(H,16,17)
InChIKeyWEERFHDTSSGJKM-UHFFFAOYSA-N
XLogP1.31
TPSA78.87 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.34
LogP ≤ 51.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[2-[(4,4-dimethylazepane-1-carbonyl)amino]ethoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-[(4,4-dimethylazepane-1-carbonyl)amino]ethoxy]acetic acid?
The IUPAC name of 2-[2-[(4,4-dimethylazepane-1-carbonyl)amino]ethoxy]acetic acid (CID 79463859) is 2-[2-[(4,4-dimethylazepane-1-carbonyl)amino]ethoxy]acetic acid.
What is the SMILES notation for 2-[2-[(4,4-dimethylazepane-1-carbonyl)amino]ethoxy]acetic acid?
The canonical SMILES for 2-[2-[(4,4-dimethylazepane-1-carbonyl)amino]ethoxy]acetic acid is CC1(C)CCCN(C(=O)NCCOCC(=O)O)CC1.
What is the InChIKey of 2-[2-[(4,4-dimethylazepane-1-carbonyl)amino]ethoxy]acetic acid?
The InChIKey is WEERFHDTSSGJKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O4/c1-13(2)4-3-7-15(8-5-13)12(18)14-6-9-19-10-11(16)17/h3-10H2,1-2H3,(H,14,18)(H,16,17).
What are the key properties of 2-[2-[(4,4-dimethylazepane-1-carbonyl)amino]ethoxy]acetic acid?
2-[2-[(4,4-dimethylazepane-1-carbonyl)amino]ethoxy]acetic acid has a molecular weight of 272.34 g/mol, XLogP of 1.31, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(4,4-dimethylazepane-1-carbonyl)amino]ethoxy]acetic acid is sourced from PubChem (CID 79463859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).