7-[(4,4-dimethylpiperidine-1-carbonyl)amino]heptanoic acid

C15H28N2O3 — CID 62931364

IUPAC7-[(4,4-dimethylpiperidine-1-carbonyl)amino]heptanoic acid
SMILESCC1(C)CCN(C(=O)NCCCCCCC(=O)O)CC1
InChIInChI=1S/C15H28N2O3/c1-15(2)8-11-17(12-9-15)14(20)16-10-6-4-3-5-7-13(18)19/h3-12H2,1-2H3,(H,16,20)(H,18,19)
InChIKeyNIZRTQWWKYCZAF-UHFFFAOYSA-N
MW284.40 g/mol
LogP2.85
Rot. Bonds7

About 7-[(4,4-dimethylpiperidine-1-carbonyl)amino]heptanoic acid

7-[(4,4-dimethylpiperidine-1-carbonyl)amino]heptanoic acid (PubChem CID 62931364) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is 7-[(4,4-dimethylpiperidine-1-carbonyl)amino]heptanoic acid.

Molecular Properties

Compound Name7-[(4,4-dimethylpiperidine-1-carbonyl)amino]heptanoic acid
PubChem CID62931364
Molecular FormulaC15H28N2O3
Molecular Weight284.40 g/mol
Exact Mass284.21
IUPAC Name7-[(4,4-dimethylpiperidine-1-carbonyl)amino]heptanoic acid
SMILESCC1(C)CCN(C(=O)NCCCCCCC(=O)O)CC1
InChIInChI=1S/C15H28N2O3/c1-15(2)8-11-17(12-9-15)14(20)16-10-6-4-3-5-7-13(18)19/h3-12H2,1-2H3,(H,16,20)(H,18,19)
InChIKeyNIZRTQWWKYCZAF-UHFFFAOYSA-N
XLogP2.85
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.40
LogP ≤ 52.85
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 7-[(4,4-dimethylpiperidine-1-carbonyl)amino]heptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-[(4,4-dimethylpiperidine-1-carbonyl)amino]heptanoic acid?
The IUPAC name of 7-[(4,4-dimethylpiperidine-1-carbonyl)amino]heptanoic acid (CID 62931364) is 7-[(4,4-dimethylpiperidine-1-carbonyl)amino]heptanoic acid.
What is the SMILES notation for 7-[(4,4-dimethylpiperidine-1-carbonyl)amino]heptanoic acid?
The canonical SMILES for 7-[(4,4-dimethylpiperidine-1-carbonyl)amino]heptanoic acid is CC1(C)CCN(C(=O)NCCCCCCC(=O)O)CC1.
What is the InChIKey of 7-[(4,4-dimethylpiperidine-1-carbonyl)amino]heptanoic acid?
The InChIKey is NIZRTQWWKYCZAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O3/c1-15(2)8-11-17(12-9-15)14(20)16-10-6-4-3-5-7-13(18)19/h3-12H2,1-2H3,(H,16,20)(H,18,19).
What are the key properties of 7-[(4,4-dimethylpiperidine-1-carbonyl)amino]heptanoic acid?
7-[(4,4-dimethylpiperidine-1-carbonyl)amino]heptanoic acid has a molecular weight of 284.40 g/mol, XLogP of 2.85, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(4,4-dimethylpiperidine-1-carbonyl)amino]heptanoic acid is sourced from PubChem (CID 62931364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).