C16H29N3O4 — CID 122021638
4-[[4-(pentylcarbamoyl)piperidine-1-carbonyl]amino]butanoic acid (PubChem CID 122021638) has the molecular formula C16H29N3O4 and a molecular weight of 327.43 g/mol. Its IUPAC name is 4-[[4-(pentylcarbamoyl)piperidine-1-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[4-(pentylcarbamoyl)piperidine-1-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 122021638 |
| Molecular Formula | C16H29N3O4 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 4-[[4-(pentylcarbamoyl)piperidine-1-carbonyl]amino]butanoic acid |
| SMILES | CCCCCNC(=O)C1CCN(C(=O)NCCCC(=O)O)CC1 |
| InChI | InChI=1S/C16H29N3O4/c1-2-3-4-9-17-15(22)13-7-11-19(12-8-13)16(23)18-10-5-6-14(20)21/h13H,2-12H2,1H3,(H,17,22)(H,18,23)(H,20,21) |
| InChIKey | WHUBDVLIOGVVJY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|