C18H34N2O3 — CID 154961304
3-(dodecylcarbamoyl)pyrrolidine-1-carboxylic acid (PubChem CID 154961304) has the molecular formula C18H34N2O3 and a molecular weight of 326.48 g/mol. Its IUPAC name is 3-(dodecylcarbamoyl)pyrrolidine-1-carboxylic acid.
| Compound Name | 3-(dodecylcarbamoyl)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 154961304 |
| Molecular Formula | C18H34N2O3 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | 3-(dodecylcarbamoyl)pyrrolidine-1-carboxylic acid |
| SMILES | CCCCCCCCCCCCNC(=O)C1CCN(C(=O)O)C1 |
| InChI | InChI=1S/C18H34N2O3/c1-2-3-4-5-6-7-8-9-10-11-13-19-17(21)16-12-14-20(15-16)18(22)23/h16H,2-15H2,1H3,(H,19,21)(H,22,23) |
| InChIKey | CECOUCQAPMOHLE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|