C10H21N3O2 — CID 167088370
N-(2-methoxyethyl)-3,4-dimethylpiperazine-1-carboxamide (PubChem CID 167088370) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3,4-dimethylpiperazine-1-carboxamide.
| Compound Name | N-(2-methoxyethyl)-3,4-dimethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 167088370 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | N-(2-methoxyethyl)-3,4-dimethylpiperazine-1-carboxamide |
| SMILES | COCCNC(=O)N1CCN(C)C(C)C1 |
| InChI | InChI=1S/C10H21N3O2/c1-9-8-13(6-5-12(9)2)10(14)11-4-7-15-3/h9H,4-8H2,1-3H3,(H,11,14) |
| InChIKey | PXNLXLIVVPOKKO-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|