C11H20N2O3 — CID 110707573
methyl 4-(3,4-dimethylpiperazin-1-yl)-4-oxobutanoate (PubChem CID 110707573) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is methyl 4-(3,4-dimethylpiperazin-1-yl)-4-oxobutanoate.
| Compound Name | methyl 4-(3,4-dimethylpiperazin-1-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 110707573 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | methyl 4-(3,4-dimethylpiperazin-1-yl)-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)N1CCN(C)C(C)C1 |
| InChI | InChI=1S/C11H20N2O3/c1-9-8-13(7-6-12(9)2)10(14)4-5-11(15)16-3/h9H,4-8H2,1-3H3 |
| InChIKey | XWDZGYICQPPZBI-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |