methyl 4-(3,4-dimethylpiperazin-1-yl)-4-oxobutanoate

C11H20N2O3 — CID 110707573

IUPACmethyl 4-(3,4-dimethylpiperazin-1-yl)-4-oxobutanoate
SMILESCOC(=O)CCC(=O)N1CCN(C)C(C)C1
InChIInChI=1S/C11H20N2O3/c1-9-8-13(7-6-12(9)2)10(14)4-5-11(15)16-3/h9H,4-8H2,1-3H3
InChIKeyXWDZGYICQPPZBI-UHFFFAOYSA-N
MW228.29 g/mol
LogP0.10
Rot. Bonds3

About methyl 4-(3,4-dimethylpiperazin-1-yl)-4-oxobutanoate

methyl 4-(3,4-dimethylpiperazin-1-yl)-4-oxobutanoate (PubChem CID 110707573) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is methyl 4-(3,4-dimethylpiperazin-1-yl)-4-oxobutanoate.

Molecular Properties

Compound Namemethyl 4-(3,4-dimethylpiperazin-1-yl)-4-oxobutanoate
PubChem CID110707573
Molecular FormulaC11H20N2O3
Molecular Weight228.29 g/mol
Exact Mass228.15
IUPAC Namemethyl 4-(3,4-dimethylpiperazin-1-yl)-4-oxobutanoate
SMILESCOC(=O)CCC(=O)N1CCN(C)C(C)C1
InChIInChI=1S/C11H20N2O3/c1-9-8-13(7-6-12(9)2)10(14)4-5-11(15)16-3/h9H,4-8H2,1-3H3
InChIKeyXWDZGYICQPPZBI-UHFFFAOYSA-N
XLogP0.10
TPSA49.85 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.29
LogP ≤ 50.10
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 4-(3,4-dimethylpiperazin-1-yl)-4-oxobutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(3,4-dimethylpiperazin-1-yl)-4-oxobutanoate?
The IUPAC name of methyl 4-(3,4-dimethylpiperazin-1-yl)-4-oxobutanoate (CID 110707573) is methyl 4-(3,4-dimethylpiperazin-1-yl)-4-oxobutanoate.
What is the SMILES notation for methyl 4-(3,4-dimethylpiperazin-1-yl)-4-oxobutanoate?
The canonical SMILES for methyl 4-(3,4-dimethylpiperazin-1-yl)-4-oxobutanoate is COC(=O)CCC(=O)N1CCN(C)C(C)C1.
What is the InChIKey of methyl 4-(3,4-dimethylpiperazin-1-yl)-4-oxobutanoate?
The InChIKey is XWDZGYICQPPZBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O3/c1-9-8-13(7-6-12(9)2)10(14)4-5-11(15)16-3/h9H,4-8H2,1-3H3.
What are the key properties of methyl 4-(3,4-dimethylpiperazin-1-yl)-4-oxobutanoate?
methyl 4-(3,4-dimethylpiperazin-1-yl)-4-oxobutanoate has a molecular weight of 228.29 g/mol, XLogP of 0.10, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(3,4-dimethylpiperazin-1-yl)-4-oxobutanoate is sourced from PubChem (CID 110707573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).