C16H24N2O3 — CID 110741082
2-(3,4-dimethoxyphenyl)-1-(3,4-dimethylpiperazin-1-yl)ethanone (PubChem CID 110741082) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1-(3,4-dimethylpiperazin-1-yl)ethanone.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1-(3,4-dimethylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 110741082 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1-(3,4-dimethylpiperazin-1-yl)ethanone |
| SMILES | COc1ccc(CC(=O)N2CCN(C)C(C)C2)cc1OC |
| InChI | InChI=1S/C16H24N2O3/c1-12-11-18(8-7-17(12)2)16(19)10-13-5-6-14(20-3)15(9-13)21-4/h5-6,9,12H,7-8,10-11H2,1-4H3 |
| InChIKey | BULXHCNLCJTONL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |