C18H25ClN2O4 — CID 108570291
4-chloro-1-[4-[2-(3,4-dimethoxyphenyl)acetyl]piperazin-1-yl]butan-1-one (PubChem CID 108570291) has the molecular formula C18H25ClN2O4 and a molecular weight of 368.86 g/mol. Its IUPAC name is 4-chloro-1-[4-[2-(3,4-dimethoxyphenyl)acetyl]piperazin-1-yl]butan-1-one.
| Compound Name | 4-chloro-1-[4-[2-(3,4-dimethoxyphenyl)acetyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 108570291 |
| Molecular Formula | C18H25ClN2O4 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 4-chloro-1-[4-[2-(3,4-dimethoxyphenyl)acetyl]piperazin-1-yl]butan-1-one |
| SMILES | COc1ccc(CC(=O)N2CCN(C(=O)CCCCl)CC2)cc1OC |
| InChI | InChI=1S/C18H25ClN2O4/c1-24-15-6-5-14(12-16(15)25-2)13-18(23)21-10-8-20(9-11-21)17(22)4-3-7-19/h5-6,12H,3-4,7-11,13H2,1-2H3 |
| InChIKey | FLIUAPVDNJZPSZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|