C15H22ClN2O3- — CID 53346891
2-(3,4-dimethoxyphenyl)-1-(4-methylpiperazin-1-yl)ethanone chloride (PubChem CID 53346891) has the molecular formula C15H22ClN2O3- and a molecular weight of 313.81 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1-(4-methylpiperazin-1-yl)ethanone chloride.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1-(4-methylpiperazin-1-yl)ethanone chloride |
|---|---|
| PubChem CID | 53346891 |
| Molecular Formula | C15H22ClN2O3- |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1-(4-methylpiperazin-1-yl)ethanone chloride |
| SMILES | COc1ccc(CC(=O)N2CCN(C)CC2)cc1OC.[Cl-] |
| InChI | InChI=1S/C15H22N2O3.ClH/c1-16-6-8-17(9-7-16)15(18)11-12-4-5-13(19-2)14(10-12)20-3;/h4-5,10H,6-9,11H2,1-3H3;1H/p-1 |
| InChIKey | CLOWDSPJWQPUEJ-UHFFFAOYSA-M |
| XLogP | -1.98 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |