C18H26N2O5 — CID 110808927
ethyl 4-[2-(3,4-dimethoxyphenyl)acetyl]-1,4-diazepane-1-carboxylate (PubChem CID 110808927) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is ethyl 4-[2-(3,4-dimethoxyphenyl)acetyl]-1,4-diazepane-1-carboxylate.
| Compound Name | ethyl 4-[2-(3,4-dimethoxyphenyl)acetyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 110808927 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | ethyl 4-[2-(3,4-dimethoxyphenyl)acetyl]-1,4-diazepane-1-carboxylate |
| SMILES | CCOC(=O)N1CCCN(C(=O)Cc2ccc(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C18H26N2O5/c1-4-25-18(22)20-9-5-8-19(10-11-20)17(21)13-14-6-7-15(23-2)16(12-14)24-3/h6-7,12H,4-5,8-11,13H2,1-3H3 |
| InChIKey | ALJBQFKFDQVZFX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |