C16H22BrNO3 — CID 102962225
1-(3-bromo-4-methylpiperidin-1-yl)-2-(3,4-dimethoxyphenyl)ethanone (PubChem CID 102962225) has the molecular formula C16H22BrNO3 and a molecular weight of 356.26 g/mol. Its IUPAC name is 1-(3-bromo-4-methylpiperidin-1-yl)-2-(3,4-dimethoxyphenyl)ethanone.
| Compound Name | 1-(3-bromo-4-methylpiperidin-1-yl)-2-(3,4-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 102962225 |
| Molecular Formula | C16H22BrNO3 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 1-(3-bromo-4-methylpiperidin-1-yl)-2-(3,4-dimethoxyphenyl)ethanone |
| SMILES | COc1ccc(CC(=O)N2CCC(C)C(Br)C2)cc1OC |
| InChI | InChI=1S/C16H22BrNO3/c1-11-6-7-18(10-13(11)17)16(19)9-12-4-5-14(20-2)15(8-12)21-3/h4-5,8,11,13H,6-7,9-10H2,1-3H3 |
| InChIKey | ACFQJEBGDVMMFI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|