C20H24N2O4 — CID 138379727
4-[1-[2-(3,4-dimethoxyphenyl)acetyl]piperidin-4-yl]-1H-pyridin-2-one (PubChem CID 138379727) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 4-[1-[2-(3,4-dimethoxyphenyl)acetyl]piperidin-4-yl]-1H-pyridin-2-one.
| Compound Name | 4-[1-[2-(3,4-dimethoxyphenyl)acetyl]piperidin-4-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 138379727 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 4-[1-[2-(3,4-dimethoxyphenyl)acetyl]piperidin-4-yl]-1H-pyridin-2-one |
| SMILES | COc1ccc(CC(=O)N2CCC(c3cc[nH]c(=O)c3)CC2)cc1OC |
| InChI | InChI=1S/C20H24N2O4/c1-25-17-4-3-14(11-18(17)26-2)12-20(24)22-9-6-15(7-10-22)16-5-8-21-19(23)13-16/h3-5,8,11,13,15H,6-7,9-10,12H2,1-2H3,(H,21,23) |
| InChIKey | TXCMQNNGIPCDHL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |