C23H25FN2O3 — CID 113087627
2-(3,4-dimethoxyphenyl)-1-[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]ethanone (PubChem CID 113087627) has the molecular formula C23H25FN2O3 and a molecular weight of 396.46 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1-[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]ethanone.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1-[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 113087627 |
| Molecular Formula | C23H25FN2O3 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1-[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]ethanone |
| SMILES | COc1ccc(CC(=O)N2CCC(c3c[nH]c4cc(F)ccc34)CC2)cc1OC |
| InChI | InChI=1S/C23H25FN2O3/c1-28-21-6-3-15(11-22(21)29-2)12-23(27)26-9-7-16(8-10-26)19-14-25-20-13-17(24)4-5-18(19)20/h3-6,11,13-14,16,25H,7-10,12H2,1-2H3 |
| InChIKey | LYRIXHWDUCREBX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |