C18H23FN2O — CID 113087593
1-[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]pentan-1-one (PubChem CID 113087593) has the molecular formula C18H23FN2O and a molecular weight of 302.39 g/mol. Its IUPAC name is 1-[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]pentan-1-one.
| Compound Name | 1-[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 113087593 |
| Molecular Formula | C18H23FN2O |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 1-[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]pentan-1-one |
| SMILES | CCCCC(=O)N1CCC(c2c[nH]c3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C18H23FN2O/c1-2-3-4-18(22)21-9-7-13(8-10-21)16-12-20-17-11-14(19)5-6-15(16)17/h5-6,11-13,20H,2-4,7-10H2,1H3 |
| InChIKey | PKKLGVWMZWTWDX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |