C21H25FN2O3 — CID 120673262
4-[4-(6-fluoro-1H-indol-3-yl)piperidine-1-carbonyl]cyclohexane-1-carboxylic acid (PubChem CID 120673262) has the molecular formula C21H25FN2O3 and a molecular weight of 372.44 g/mol. Its IUPAC name is 4-[4-(6-fluoro-1H-indol-3-yl)piperidine-1-carbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-(6-fluoro-1H-indol-3-yl)piperidine-1-carbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120673262 |
| Molecular Formula | C21H25FN2O3 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 4-[4-(6-fluoro-1H-indol-3-yl)piperidine-1-carbonyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)N2CCC(c3c[nH]c4cc(F)ccc34)CC2)CC1 |
| InChI | InChI=1S/C21H25FN2O3/c22-16-5-6-17-18(12-23-19(17)11-16)13-7-9-24(10-8-13)20(25)14-1-3-15(4-2-14)21(26)27/h5-6,11-15,23H,1-4,7-10H2,(H,26,27) |
| InChIKey | ZQGWAWMDMOHAPF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |