C21H21FN2O2 — CID 113087621
1-[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]-2-phenoxyethanone (PubChem CID 113087621) has the molecular formula C21H21FN2O2 and a molecular weight of 352.41 g/mol. Its IUPAC name is 1-[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]-2-phenoxyethanone.
| Compound Name | 1-[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 113087621 |
| Molecular Formula | C21H21FN2O2 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 1-[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]-2-phenoxyethanone |
| SMILES | O=C(COc1ccccc1)N1CCC(c2c[nH]c3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C21H21FN2O2/c22-16-6-7-18-19(13-23-20(18)12-16)15-8-10-24(11-9-15)21(25)14-26-17-4-2-1-3-5-17/h1-7,12-13,15,23H,8-11,14H2 |
| InChIKey | SNFYVEFLIHFRME-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |