C17H23FN2O — CID 145286856
ethane;1-[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]ethanone (PubChem CID 145286856) has the molecular formula C17H23FN2O and a molecular weight of 290.38 g/mol. Its IUPAC name is ethane;1-[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]ethanone.
| Compound Name | ethane;1-[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 145286856 |
| Molecular Formula | C17H23FN2O |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | ethane;1-[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]ethanone |
| SMILES | CC.CC(=O)N1CCC(c2c[nH]c3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C15H17FN2O.C2H6/c1-10(19)18-6-4-11(5-7-18)14-9-17-15-8-12(16)2-3-13(14)15;1-2/h2-3,8-9,11,17H,4-7H2,1H3;1-2H3 |
| InChIKey | HDPMHTZCFHGSGG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |