C15H17FN2O2 — CID 141141567
2-[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]acetic acid (PubChem CID 141141567) has the molecular formula C15H17FN2O2 and a molecular weight of 276.31 g/mol. Its IUPAC name is 2-[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]acetic acid.
| Compound Name | 2-[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 141141567 |
| Molecular Formula | C15H17FN2O2 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-[4-(6-fluoro-1H-indol-3-yl)piperidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCC(c2c[nH]c3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C15H17FN2O2/c16-11-1-2-12-13(8-17-14(12)7-11)10-3-5-18(6-4-10)9-15(19)20/h1-2,7-8,10,17H,3-6,9H2,(H,19,20) |
| InChIKey | CAEMSLPRJKEYSR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |