C20H24FN3O2 — CID 166248374
3-ethyl-3-[4-(6-fluoro-1H-indol-3-yl)piperidine-1-carbonyl]pyrrolidin-2-one (PubChem CID 166248374) has the molecular formula C20H24FN3O2 and a molecular weight of 357.43 g/mol. Its IUPAC name is 3-ethyl-3-[4-(6-fluoro-1H-indol-3-yl)piperidine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 3-ethyl-3-[4-(6-fluoro-1H-indol-3-yl)piperidine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 166248374 |
| Molecular Formula | C20H24FN3O2 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 3-ethyl-3-[4-(6-fluoro-1H-indol-3-yl)piperidine-1-carbonyl]pyrrolidin-2-one |
| SMILES | CCC1(C(=O)N2CCC(c3c[nH]c4cc(F)ccc34)CC2)CCNC1=O |
| InChI | InChI=1S/C20H24FN3O2/c1-2-20(7-8-22-18(20)25)19(26)24-9-5-13(6-10-24)16-12-23-17-11-14(21)3-4-15(16)17/h3-4,11-13,23H,2,5-10H2,1H3,(H,22,25) |
| InChIKey | GGHNBFKIMOHJFW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|