C21H20ClFN2O — CID 113087714
1-[4-(6-chloro-1H-indol-3-yl)piperidin-1-yl]-2-(3-fluorophenyl)ethanone (PubChem CID 113087714) has the molecular formula C21H20ClFN2O and a molecular weight of 370.86 g/mol. Its IUPAC name is 1-[4-(6-chloro-1H-indol-3-yl)piperidin-1-yl]-2-(3-fluorophenyl)ethanone.
| Compound Name | 1-[4-(6-chloro-1H-indol-3-yl)piperidin-1-yl]-2-(3-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 113087714 |
| Molecular Formula | C21H20ClFN2O |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 1-[4-(6-chloro-1H-indol-3-yl)piperidin-1-yl]-2-(3-fluorophenyl)ethanone |
| SMILES | O=C(Cc1cccc(F)c1)N1CCC(c2c[nH]c3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C21H20ClFN2O/c22-16-4-5-18-19(13-24-20(18)12-16)15-6-8-25(9-7-15)21(26)11-14-2-1-3-17(23)10-14/h1-5,10,12-13,15,24H,6-9,11H2 |
| InChIKey | GPBAAVRTCIVSMM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |