C22H23FN2O3 — CID 113087390
(3,4-dimethoxyphenyl)-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]methanone (PubChem CID 113087390) has the molecular formula C22H23FN2O3 and a molecular weight of 382.44 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]methanone.
| Compound Name | (3,4-dimethoxyphenyl)-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 113087390 |
| Molecular Formula | C22H23FN2O3 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | (3,4-dimethoxyphenyl)-[4-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCC(c3c[nH]c4ccc(F)cc34)CC2)cc1OC |
| InChI | InChI=1S/C22H23FN2O3/c1-27-20-6-3-15(11-21(20)28-2)22(26)25-9-7-14(8-10-25)18-13-24-19-5-4-16(23)12-17(18)19/h3-6,11-14,24H,7-10H2,1-2H3 |
| InChIKey | FCCQOXKFQUZIDW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |