C21H22N2O2 — CID 84559095
[4-(1H-indol-3-yl)piperidin-1-yl]-(2-methoxyphenyl)methanone (PubChem CID 84559095) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is [4-(1H-indol-3-yl)piperidin-1-yl]-(2-methoxyphenyl)methanone.
| Compound Name | [4-(1H-indol-3-yl)piperidin-1-yl]-(2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 84559095 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | [4-(1H-indol-3-yl)piperidin-1-yl]-(2-methoxyphenyl)methanone |
| SMILES | COc1ccccc1C(=O)N1CCC(c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C21H22N2O2/c1-25-20-9-5-3-7-17(20)21(24)23-12-10-15(11-13-23)18-14-22-19-8-4-2-6-16(18)19/h2-9,14-15,22H,10-13H2,1H3 |
| InChIKey | WDYXMWKCLVSJCA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |