C22H22F2N2O3 — CID 55510978
[2-(difluoromethoxy)-3-methoxyphenyl]-[4-(1H-indol-3-yl)piperidin-1-yl]methanone (PubChem CID 55510978) has the molecular formula C22H22F2N2O3 and a molecular weight of 400.43 g/mol. Its IUPAC name is [2-(difluoromethoxy)-3-methoxyphenyl]-[4-(1H-indol-3-yl)piperidin-1-yl]methanone.
| Compound Name | [2-(difluoromethoxy)-3-methoxyphenyl]-[4-(1H-indol-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 55510978 |
| Molecular Formula | C22H22F2N2O3 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | [2-(difluoromethoxy)-3-methoxyphenyl]-[4-(1H-indol-3-yl)piperidin-1-yl]methanone |
| SMILES | COc1cccc(C(=O)N2CCC(c3c[nH]c4ccccc34)CC2)c1OC(F)F |
| InChI | InChI=1S/C22H22F2N2O3/c1-28-19-8-4-6-16(20(19)29-22(23)24)21(27)26-11-9-14(10-12-26)17-13-25-18-7-3-2-5-15(17)18/h2-8,13-14,22,25H,9-12H2,1H3 |
| InChIKey | ZFWBFIGUDUHDLI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |