C21H22N2O — CID 84559294
[4-(1H-indol-3-yl)piperidin-1-yl]-(2-methylphenyl)methanone (PubChem CID 84559294) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is [4-(1H-indol-3-yl)piperidin-1-yl]-(2-methylphenyl)methanone.
| Compound Name | [4-(1H-indol-3-yl)piperidin-1-yl]-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 84559294 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | [4-(1H-indol-3-yl)piperidin-1-yl]-(2-methylphenyl)methanone |
| SMILES | Cc1ccccc1C(=O)N1CCC(c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C21H22N2O/c1-15-6-2-3-7-17(15)21(24)23-12-10-16(11-13-23)19-14-22-20-9-5-4-8-18(19)20/h2-9,14,16,22H,10-13H2,1H3 |
| InChIKey | LWWVQCIYHLWIOJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |