C25H23N3O2 — CID 24646101
[4-(1H-indol-3-yl)piperidin-1-yl]-(2-phenoxy-3-pyridinyl)methanone (PubChem CID 24646101) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is [4-(1H-indol-3-yl)piperidin-1-yl]-(2-phenoxy-3-pyridinyl)methanone.
| Compound Name | [4-(1H-indol-3-yl)piperidin-1-yl]-(2-phenoxy-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 24646101 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | [4-(1H-indol-3-yl)piperidin-1-yl]-(2-phenoxy-3-pyridinyl)methanone |
| SMILES | O=C(c1cccnc1Oc1ccccc1)N1CCC(c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C25H23N3O2/c29-25(21-10-6-14-26-24(21)30-19-7-2-1-3-8-19)28-15-12-18(13-16-28)22-17-27-23-11-5-4-9-20(22)23/h1-11,14,17-18,27H,12-13,15-16H2 |
| InChIKey | SIGZNQSKGDXUJD-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |