C18H23FN2O2 — CID 22714417
tert-butyl 4-(5-fluoro-1H-indol-3-yl)piperidine-1-carboxylate (PubChem CID 22714417) has the molecular formula C18H23FN2O2 and a molecular weight of 318.39 g/mol. Its IUPAC name is tert-butyl 4-(5-fluoro-1H-indol-3-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-fluoro-1H-indol-3-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22714417 |
| Molecular Formula | C18H23FN2O2 |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | tert-butyl 4-(5-fluoro-1H-indol-3-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2c[nH]c3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C18H23FN2O2/c1-18(2,3)23-17(22)21-8-6-12(7-9-21)15-11-20-16-5-4-13(19)10-14(15)16/h4-5,10-12,20H,6-9H2,1-3H3 |
| InChIKey | QYTJFOBUAJLXAR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |