C22H29ClN2O2 — CID 139510374
tert-butyl 4-[5-[(S)-chloro(cyclopropyl)methyl]-1H-indol-3-yl]piperidine-1-carboxylate (PubChem CID 139510374) has the molecular formula C22H29ClN2O2 and a molecular weight of 388.94 g/mol. Its IUPAC name is tert-butyl 4-[5-[(S)-chloro(cyclopropyl)methyl]-1H-indol-3-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[(S)-chloro(cyclopropyl)methyl]-1H-indol-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 139510374 |
| Molecular Formula | C22H29ClN2O2 |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | tert-butyl 4-[5-[(S)-chloro(cyclopropyl)methyl]-1H-indol-3-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2c[nH]c3ccc([C@@H](Cl)C4CC4)cc23)CC1 |
| InChI | InChI=1S/C22H29ClN2O2/c1-22(2,3)27-21(26)25-10-8-14(9-11-25)18-13-24-19-7-6-16(12-17(18)19)20(23)15-4-5-15/h6-7,12-15,20,24H,4-5,8-11H2,1-3H3/t20-/m0/s1 |
| InChIKey | LLOMHWOUPDNJJR-FQEVSTJZSA-N |
| XLogP | 5.97 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|