C26H40N4O3 — CID 123560284
tert-butyl 4-[2-amino-2-hydroxy-1-[[4-(1H-indol-3-yl)cyclohexyl]amino]ethyl]piperidine-1-carboxylate (PubChem CID 123560284) has the molecular formula C26H40N4O3 and a molecular weight of 456.63 g/mol. Its IUPAC name is tert-butyl 4-[2-amino-2-hydroxy-1-[[4-(1H-indol-3-yl)cyclohexyl]amino]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-amino-2-hydroxy-1-[[4-(1H-indol-3-yl)cyclohexyl]amino]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123560284 |
| Molecular Formula | C26H40N4O3 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | tert-butyl 4-[2-amino-2-hydroxy-1-[[4-(1H-indol-3-yl)cyclohexyl]amino]ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(NC2CCC(c3c[nH]c4ccccc34)CC2)C(N)O)CC1 |
| InChI | InChI=1S/C26H40N4O3/c1-26(2,3)33-25(32)30-14-12-18(13-15-30)23(24(27)31)29-19-10-8-17(9-11-19)21-16-28-22-7-5-4-6-20(21)22/h4-7,16-19,23-24,28-29,31H,8-15,27H2,1-3H3 |
| InChIKey | SCVPJYIQYCCJBQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 103.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|