C20H28N2O2 — CID 142594147
tert-butyl 4-(3,4-dimethyl-1H-indol-5-yl)piperidine-1-carboxylate (PubChem CID 142594147) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is tert-butyl 4-(3,4-dimethyl-1H-indol-5-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(3,4-dimethyl-1H-indol-5-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142594147 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | tert-butyl 4-(3,4-dimethyl-1H-indol-5-yl)piperidine-1-carboxylate |
| SMILES | Cc1c[nH]c2ccc(C3CCN(C(=O)OC(C)(C)C)CC3)c(C)c12 |
| InChI | InChI=1S/C20H28N2O2/c1-13-12-21-17-7-6-16(14(2)18(13)17)15-8-10-22(11-9-15)19(23)24-20(3,4)5/h6-7,12,15,21H,8-11H2,1-5H3 |
| InChIKey | FTFYDPGRFKWQKM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |