C15H23BrN2O2 — CID 175068445
tert-butyl 4-(4-bromo-3-methyl-1H-pyrrol-2-yl)piperidine-1-carboxylate (PubChem CID 175068445) has the molecular formula C15H23BrN2O2 and a molecular weight of 343.27 g/mol. Its IUPAC name is tert-butyl 4-(4-bromo-3-methyl-1H-pyrrol-2-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-bromo-3-methyl-1H-pyrrol-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175068445 |
| Molecular Formula | C15H23BrN2O2 |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | tert-butyl 4-(4-bromo-3-methyl-1H-pyrrol-2-yl)piperidine-1-carboxylate |
| SMILES | Cc1c(Br)c[nH]c1C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H23BrN2O2/c1-10-12(16)9-17-13(10)11-5-7-18(8-6-11)14(19)20-15(2,3)4/h9,11,17H,5-8H2,1-4H3 |
| InChIKey | BDPCUFBTBJIPJQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |