C17H23BrFNO2 — CID 121339633
tert-butyl 4-[2-bromo-5-(fluoromethyl)phenyl]piperidine-1-carboxylate (PubChem CID 121339633) has the molecular formula C17H23BrFNO2 and a molecular weight of 372.28 g/mol. Its IUPAC name is tert-butyl 4-[2-bromo-5-(fluoromethyl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-bromo-5-(fluoromethyl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 121339633 |
| Molecular Formula | C17H23BrFNO2 |
| Molecular Weight | 372.28 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | tert-butyl 4-[2-bromo-5-(fluoromethyl)phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cc(CF)ccc2Br)CC1 |
| InChI | InChI=1S/C17H23BrFNO2/c1-17(2,3)22-16(21)20-8-6-13(7-9-20)14-10-12(11-19)4-5-15(14)18/h4-5,10,13H,6-9,11H2,1-3H3 |
| InChIKey | JINSVAHVEDXZIU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.28 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |