C20H31BrN2O2 — CID 170437093
tert-butyl 4-[4-bromo-2-(tert-butylamino)phenyl]piperidine-1-carboxylate (PubChem CID 170437093) has the molecular formula C20H31BrN2O2 and a molecular weight of 411.38 g/mol. Its IUPAC name is tert-butyl 4-[4-bromo-2-(tert-butylamino)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-bromo-2-(tert-butylamino)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170437093 |
| Molecular Formula | C20H31BrN2O2 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | tert-butyl 4-[4-bromo-2-(tert-butylamino)phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)Nc1cc(Br)ccc1C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H31BrN2O2/c1-19(2,3)22-17-13-15(21)7-8-16(17)14-9-11-23(12-10-14)18(24)25-20(4,5)6/h7-8,13-14,22H,9-12H2,1-6H3 |
| InChIKey | XTMLZYBGXOKKPC-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |